C20H21Cl3N2O4S — CID 21367006
4-methoxy-3-(4-methylpiperidine-1-carbonyl)-N-(2,4,5-trichlorophenyl)benzenesulfonamide (PubChem CID 21367006) has the molecular formula C20H21Cl3N2O4S and a molecular weight of 491.82 g/mol. Its IUPAC name is 4-methoxy-3-(4-methylpiperidine-1-carbonyl)-N-(2,4,5-trichlorophenyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-(4-methylpiperidine-1-carbonyl)-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21367006 |
| Molecular Formula | C20H21Cl3N2O4S |
| Molecular Weight | 491.82 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 4-methoxy-3-(4-methylpiperidine-1-carbonyl)-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H21Cl3N2O4S/c1-12-5-7-25(8-6-12)20(26)14-9-13(3-4-19(14)29-2)30(27,28)24-18-11-16(22)15(21)10-17(18)23/h3-4,9-12,24H,5-8H2,1-2H3 |
| InChIKey | NHGVKJZSMCJQJK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|