C24H23N3O7S — CID 133164974
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]acetamide (PubChem CID 133164974) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 133164974 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H23N3O7S/c1-17(18-10-11-22-23(14-18)34-13-12-33-22)25-24(28)16-26(19-6-5-7-20(15-19)27(29)30)35(31,32)21-8-3-2-4-9-21/h2-11,14-15,17H,12-13,16H2,1H3,(H,25,28) |
| InChIKey | FILIOKGZXAASGP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|