C31H30N6O10S2 — CID 43891787
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]propyl]acetamide (PubChem CID 43891787) has the molecular formula C31H30N6O10S2 and a molecular weight of 710.75 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 43891787 |
| Molecular Formula | C31H30N6O10S2 |
| Molecular Weight | 710.75 g/mol |
| Exact Mass | 710.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]propyl]acetamide |
| SMILES | CC(CNC(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)NC(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H30N6O10S2/c1-23(33-31(39)22-35(25-11-9-13-27(19-25)37(42)43)49(46,47)29-16-6-3-7-17-29)20-32-30(38)21-34(24-10-8-12-26(18-24)36(40)41)48(44,45)28-14-4-2-5-15-28/h2-19,23H,20-22H2,1H3,(H,32,38)(H,33,39) |
| InChIKey | QZMZVDJMFCXBHD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 219.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|