C24H25N3O8S — CID 30209119
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 30209119) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30209119 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CN(c2cccc([N+](=O)[O-])c2)S(=O)(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25N3O8S/c1-33-21-12-17(13-22(34-2)24(21)35-3)15-25-23(28)16-26(18-8-7-9-19(14-18)27(29)30)36(31,32)20-10-5-4-6-11-20/h4-14H,15-16H2,1-3H3,(H,25,28) |
| InChIKey | RLCFNJHAZUZWIQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|