C20H24N2O5S2 — CID 133165605
3-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 133165605) has the molecular formula C20H24N2O5S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | 3-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 133165605 |
| Molecular Formula | C20H24N2O5S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C20H24N2O5S2/c1-14-13-18(10-11-19(14)22-12-4-5-20(22)23)29(26,27)21-15(2)16-6-8-17(9-7-16)28(3,24)25/h6-11,13,15,21H,4-5,12H2,1-3H3 |
| InChIKey | UCPNLIVDMPRSLZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |