C21H27NO4S — CID 133165649
2-(3,4-dimethylphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide (PubChem CID 133165649) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133165649 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
| SMILES | CCC(Oc1ccc(C)c(C)c1)C(=O)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-6-20(26-18-10-7-14(2)15(3)13-18)21(23)22-16(4)17-8-11-19(12-9-17)27(5,24)25/h7-13,16,20H,6H2,1-5H3,(H,22,23) |
| InChIKey | SZYADNXFRVOUHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |