C24H33NO4 — CID 43906025
N-[1-(3,4-diethoxyphenyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 43906025) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 43906025 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CCOc1ccc(C(C)NC(=O)C(CC)Oc2ccc(C)c(C)c2)cc1OCC |
| InChI | InChI=1S/C24H33NO4/c1-7-21(29-20-12-10-16(4)17(5)14-20)24(26)25-18(6)19-11-13-22(27-8-2)23(15-19)28-9-3/h10-15,18,21H,7-9H2,1-6H3,(H,25,26) |
| InChIKey | DMZDDJUUVMJJQL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |