C24H29N3O5S — CID 133167045
1-(benzenesulfonyl)-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 133167045) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133167045 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccccc1NC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O5S/c28-23(18-12-14-27(15-13-18)33(30,31)20-8-2-1-3-9-20)26-22-11-5-4-10-21(22)24(29)25-17-19-7-6-16-32-19/h1-5,8-11,18-19H,6-7,12-17H2,(H,25,29)(H,26,28) |
| InChIKey | KEXVYALICKDTMW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |