C14H21N3O3 — CID 133168460
4-amino-5-(1-methoxypropan-2-yloxy)-1-(oxolan-2-ylmethyl)pyrrole-2-carbonitrile (PubChem CID 133168460) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-amino-5-(1-methoxypropan-2-yloxy)-1-(oxolan-2-ylmethyl)pyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-(1-methoxypropan-2-yloxy)-1-(oxolan-2-ylmethyl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 133168460 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-amino-5-(1-methoxypropan-2-yloxy)-1-(oxolan-2-ylmethyl)pyrrole-2-carbonitrile |
| SMILES | COCC(C)Oc1c(N)cc(C#N)n1CC1CCCO1 |
| InChI | InChI=1S/C14H21N3O3/c1-10(9-18-2)20-14-13(16)6-11(7-15)17(14)8-12-4-3-5-19-12/h6,10,12H,3-5,8-9,16H2,1-2H3 |
| InChIKey | FFESMGHYNSSJNG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |