C12H13N5OS — CID 6952139
2,4-diamino-1-[[(2R)-oxolan-2-yl]methyl]-6-sulfanylidenepyridine-3,5-dicarbonitrile (PubChem CID 6952139) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 2,4-diamino-1-[[(2R)-oxolan-2-yl]methyl]-6-sulfanylidenepyridine-3,5-dicarbonitrile.
| Compound Name | 2,4-diamino-1-[[(2R)-oxolan-2-yl]methyl]-6-sulfanylidenepyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 6952139 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2,4-diamino-1-[[(2R)-oxolan-2-yl]methyl]-6-sulfanylidenepyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(=S)n(C[C@H]2CCCO2)c1N |
| InChI | InChI=1S/C12H13N5OS/c13-4-8-10(15)9(5-14)12(19)17(11(8)16)6-7-2-1-3-18-7/h7H,1-3,6,15-16H2/t7-/m1/s1 |
| InChIKey | OZKDSBYVJWAJOR-SSDOTTSWSA-N |
| XLogP | 1.30 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|