C27H24Cl2N2O3 — CID 133169261
N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133169261) has the molecular formula C27H24Cl2N2O3 and a molecular weight of 495.41 g/mol. Its IUPAC name is N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133169261 |
| Molecular Formula | C27H24Cl2N2O3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C/c2c(OCc3ccc(Cl)c(Cl)c3)ccc3ccccc23)cc1OC |
| InChI | InChI=1S/C27H24Cl2N2O3/c1-32-26-11-8-18(14-27(26)33-2)15-30-31-16-22-21-6-4-3-5-20(21)9-12-25(22)34-17-19-7-10-23(28)24(29)13-19/h3-14,16,30H,15,17H2,1-2H3/b31-16+ |
| InChIKey | WYIWQBSCPFWNHJ-WCMJOSRZSA-N |
| XLogP | 6.87 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|