C24H28F3N3O — CID 133170492
3-(trifluoromethyl)-N-[(E)-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170492) has the molecular formula C24H28F3N3O and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-[(E)-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3-(trifluoromethyl)-N-[(E)-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170492 |
| Molecular Formula | C24H28F3N3O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-(trifluoromethyl)-N-[(E)-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CC1CC(C)(C)N(C(C)C)c2ccc(/C=N/NC(=O)c3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C24H28F3N3O/c1-15(2)30-21-10-9-17(11-20(21)16(3)13-23(30,4)5)14-28-29-22(31)18-7-6-8-19(12-18)24(25,26)27/h6-12,14-16H,13H2,1-5H3,(H,29,31)/b28-14+ |
| InChIKey | XWKYJKRNSANFQK-CCVNUDIWSA-N |
| XLogP | 5.97 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|