C22H27BrN2O2S — CID 133173320
2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butan-2-ylpropanamide (PubChem CID 133173320) has the molecular formula C22H27BrN2O2S and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butan-2-ylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 133173320 |
| Molecular Formula | C22H27BrN2O2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H27BrN2O2S/c1-4-16(2)24-22(27)17(3)25(14-18-10-12-19(23)13-11-18)21(26)15-28-20-8-6-5-7-9-20/h5-13,16-17H,4,14-15H2,1-3H3,(H,24,27) |
| InChIKey | TZCGGUYAEKYCHI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |