C22H27BrN2O2S — CID 100572611
(2S)-2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butylpropanamide (PubChem CID 100572611) has the molecular formula C22H27BrN2O2S and a molecular weight of 463.44 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100572611 |
| Molecular Formula | C22H27BrN2O2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-(2-phenylsulfanylacetyl)amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccc(Br)cc1)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H27BrN2O2S/c1-3-4-14-24-22(27)17(2)25(15-18-10-12-19(23)13-11-18)21(26)16-28-20-8-6-5-7-9-20/h5-13,17H,3-4,14-16H2,1-2H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | ITCOIBVXKFFASH-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|