C21H25BrN2O2S — CID 132612736
2-[(4-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-ethylpropanamide (PubChem CID 132612736) has the molecular formula C21H25BrN2O2S and a molecular weight of 449.41 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-ethylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132612736 |
| Molecular Formula | C21H25BrN2O2S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C21H25BrN2O2S/c1-3-23-21(26)16(2)24(15-17-9-11-18(22)12-10-17)20(25)13-14-27-19-7-5-4-6-8-19/h4-12,16H,3,13-15H2,1-2H3,(H,23,26) |
| InChIKey | AYAXHCCUBHAQCO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |