C16H25NO4 — CID 133179107
4-methoxy-N-(1-methoxypropan-2-yl)-3-(propoxymethyl)benzamide (PubChem CID 133179107) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-methoxy-N-(1-methoxypropan-2-yl)-3-(propoxymethyl)benzamide.
| Compound Name | 4-methoxy-N-(1-methoxypropan-2-yl)-3-(propoxymethyl)benzamide |
|---|---|
| PubChem CID | 133179107 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-methoxy-N-(1-methoxypropan-2-yl)-3-(propoxymethyl)benzamide |
| SMILES | CCCOCc1cc(C(=O)NC(C)COC)ccc1OC |
| InChI | InChI=1S/C16H25NO4/c1-5-8-21-11-14-9-13(6-7-15(14)20-4)16(18)17-12(2)10-19-3/h6-7,9,12H,5,8,10-11H2,1-4H3,(H,17,18) |
| InChIKey | XYVIPQJELFXUDC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|