C21H26ClNO4 — CID 133221280
3-[(4-chloro-3-methylphenoxy)methyl]-4-ethoxy-N-(1-methoxypropan-2-yl)benzamide (PubChem CID 133221280) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 3-[(4-chloro-3-methylphenoxy)methyl]-4-ethoxy-N-(1-methoxypropan-2-yl)benzamide.
| Compound Name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-ethoxy-N-(1-methoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 133221280 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-ethoxy-N-(1-methoxypropan-2-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C)COC)cc1COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C21H26ClNO4/c1-5-26-20-9-6-16(21(24)23-15(3)12-25-4)11-17(20)13-27-18-7-8-19(22)14(2)10-18/h6-11,15H,5,12-13H2,1-4H3,(H,23,24) |
| InChIKey | XPVQBDMJYRRUCE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |