C27H31NO4 — CID 133254130
4-ethoxy-3-[(3-methoxyphenoxy)methyl]-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 133254130) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-ethoxy-3-[(3-methoxyphenoxy)methyl]-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 4-ethoxy-3-[(3-methoxyphenoxy)methyl]-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 133254130 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 4-ethoxy-3-[(3-methoxyphenoxy)methyl]-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C)CCc2ccccc2)cc1COc1cccc(OC)c1 |
| InChI | InChI=1S/C27H31NO4/c1-4-31-26-16-15-22(17-23(26)19-32-25-12-8-11-24(18-25)30-3)27(29)28-20(2)13-14-21-9-6-5-7-10-21/h5-12,15-18,20H,4,13-14,19H2,1-3H3,(H,28,29) |
| InChIKey | CCXGWVSKMSULSC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |