C19H22BrNO2 — CID 2947744
5-bromo-2-ethoxy-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 2947744) has the molecular formula C19H22BrNO2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 2947744 |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C19H22BrNO2/c1-3-23-18-12-11-16(20)13-17(18)19(22)21-14(2)9-10-15-7-5-4-6-8-15/h4-8,11-14H,3,9-10H2,1-2H3,(H,21,22) |
| InChIKey | WUEKTNFHHJSSMR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |