C19H20BrNO3 — CID 7820162
2-(4-bromo-2-formylphenoxy)-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 7820162) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7820162 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COc1ccc(Br)cc1C=O |
| InChI | InChI=1S/C19H20BrNO3/c1-14(7-8-15-5-3-2-4-6-15)21-19(23)13-24-18-10-9-17(20)11-16(18)12-22/h2-6,9-12,14H,7-8,13H2,1H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | XIJUGDSAUYAPBK-CQSZACIVSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|