C21H18BrNO3 — CID 9007013
2-(4-bromo-2-formylphenoxy)-N-[(1S)-1-naphthalen-1-ylethyl]acetamide (PubChem CID 9007013) has the molecular formula C21H18BrNO3 and a molecular weight of 412.28 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[(1S)-1-naphthalen-1-ylethyl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[(1S)-1-naphthalen-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 9007013 |
| Molecular Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[(1S)-1-naphthalen-1-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)COc1ccc(Br)cc1C=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18BrNO3/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)23-21(25)13-26-20-10-9-17(22)11-16(20)12-24/h2-12,14H,13H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | SQHOCQRQHIPXCR-AWEZNQCLSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|