C22H29N3O4S — CID 133184690
N-[[4-(diethylamino)phenyl]methyl]-7-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133184690) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-7-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-7-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133184690 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-7-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)C2CN(S(C)(=O)=O)c3ccc(C)cc3O2)cc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-5-24(6-2)18-10-8-17(9-11-18)14-23-22(26)21-15-25(30(4,27)28)19-12-7-16(3)13-20(19)29-21/h7-13,21H,5-6,14-15H2,1-4H3,(H,23,26) |
| InChIKey | OUHXZIWDKFYHRA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|