C25H35NO3 — CID 133185590
N-[2-(4-tert-butylphenoxy)ethyl]-2-(5-methyl-2-propan-2-ylphenoxy)propanamide (PubChem CID 133185590) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-(5-methyl-2-propan-2-ylphenoxy)propanamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(5-methyl-2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 133185590 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(5-methyl-2-propan-2-ylphenoxy)propanamide |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)NCCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H35NO3/c1-17(2)22-13-8-18(3)16-23(22)29-19(4)24(27)26-14-15-28-21-11-9-20(10-12-21)25(5,6)7/h8-13,16-17,19H,14-15H2,1-7H3,(H,26,27) |
| InChIKey | UYHJJOFVEMTPTM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|