C25H34N2O6S — CID 133234915
2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133234915) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133234915 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)NCCOc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C25H34N2O6S/c1-18(2)23-10-5-19(3)17-24(23)33-20(4)25(28)26-11-14-32-21-6-8-22(9-7-21)34(29,30)27-12-15-31-16-13-27/h5-10,17-18,20H,11-16H2,1-4H3,(H,26,28) |
| InChIKey | QDLIQOOQNWIRFI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|