C23H32N2O5S — CID 133185613
2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[2-(4-propylphenoxy)ethyl]butanamide (PubChem CID 133185613) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[2-(4-propylphenoxy)ethyl]butanamide.
| Compound Name | 2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[2-(4-propylphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 133185613 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[2-(4-propylphenoxy)ethyl]butanamide |
| SMILES | CCCc1ccc(OCCNC(=O)C(CC)Oc2ccc(N(C)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O5S/c1-5-7-18-8-12-20(13-9-18)29-17-16-24-23(26)22(6-2)30-21-14-10-19(11-15-21)25(3)31(4,27)28/h8-15,22H,5-7,16-17H2,1-4H3,(H,24,26) |
| InChIKey | NYLUYRVGPLIFTK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|