C20H26ClNO3S — CID 133186551
1-(4-chlorophenyl)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]methanesulfonamide (PubChem CID 133186551) has the molecular formula C20H26ClNO3S and a molecular weight of 395.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 133186551 |
| Molecular Formula | C20H26ClNO3S |
| Molecular Weight | 395.95 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]methanesulfonamide |
| SMILES | COc1cc(C)c(C(C)NS(=O)(=O)Cc2ccc(Cl)cc2)cc1C(C)C |
| InChI | InChI=1S/C20H26ClNO3S/c1-13(2)18-11-19(14(3)10-20(18)25-5)15(4)22-26(23,24)12-16-6-8-17(21)9-7-16/h6-11,13,15,22H,12H2,1-5H3 |
| InChIKey | RFWHYAQOXXLKRQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |