About 4-chloro-3-nitrobenzoyl azide
4-chloro-3-nitrobenzoyl azide (PubChem CID 133188482) has the molecular formula C7H3ClN4O3
and a molecular weight of 226.58 g/mol. Its IUPAC name is 4-chloro-3-nitrobenzoyl azide.
Molecular Properties
| Compound Name | 4-chloro-3-nitrobenzoyl azide |
| PubChem CID | 133188482 |
| Molecular Formula | C7H3ClN4O3 |
| Molecular Weight | 226.58 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 4-chloro-3-nitrobenzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H3ClN4O3/c8-5-2-1-4(7(13)10-11-9)3-6(5)12(14)15/h1-3H |
| InChIKey | UOCIYAIVZBRXIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-nitrobenzoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-nitrobenzoyl azide?
The IUPAC name of 4-chloro-3-nitrobenzoyl azide (CID 133188482) is 4-chloro-3-nitrobenzoyl azide.
What is the SMILES notation for 4-chloro-3-nitrobenzoyl azide?
The canonical SMILES for 4-chloro-3-nitrobenzoyl azide is [N-]=[N+]=NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 4-chloro-3-nitrobenzoyl azide?
The InChIKey is UOCIYAIVZBRXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4O3/c8-5-2-1-4(7(13)10-11-9)3-6(5)12(14)15/h1-3H.
What are the key properties of 4-chloro-3-nitrobenzoyl azide?
4-chloro-3-nitrobenzoyl azide has a molecular weight of 226.58 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-nitrobenzoyl azide is sourced from PubChem (CID 133188482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).