C25H27NO2 — CID 133189081
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 133189081) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 133189081 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CCC(Oc1ccc2ccccc2c1)C(=O)NC(C)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C25H27NO2/c1-3-24(28-23-14-13-18-7-4-5-8-22(18)16-23)25(27)26-17(2)20-12-11-19-9-6-10-21(19)15-20/h4-5,7-8,11-17,24H,3,6,9-10H2,1-2H3,(H,26,27) |
| InChIKey | NEYQSICVYGJBGP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |