C20H19NO2 — CID 133189144
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 133189144) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 133189144 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccccc2o1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H19NO2/c1-13(15-10-9-14-6-4-7-16(14)11-15)21-20(22)19-12-17-5-2-3-8-18(17)23-19/h2-3,5,8-13H,4,6-7H2,1H3,(H,21,22) |
| InChIKey | AXGRYLPXPSOZBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |