C16H21FN2O — CID 13319879
3-[3-(azepan-1-yl)propyl]-6-fluoro-1,2-benzoxazole (PubChem CID 13319879) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-[3-(azepan-1-yl)propyl]-6-fluoro-1,2-benzoxazole.
| Compound Name | 3-[3-(azepan-1-yl)propyl]-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 13319879 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-[3-(azepan-1-yl)propyl]-6-fluoro-1,2-benzoxazole |
| SMILES | Fc1ccc2c(CCCN3CCCCCC3)noc2c1 |
| InChI | InChI=1S/C16H21FN2O/c17-13-7-8-14-15(18-20-16(14)12-13)6-5-11-19-9-3-1-2-4-10-19/h7-8,12H,1-6,9-11H2 |
| InChIKey | ZTIPQKIUVFKYRF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |