C25H27IN2O3S — CID 133200498
4-[(4-iodo-2-methyl-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide (PubChem CID 133200498) has the molecular formula C25H27IN2O3S and a molecular weight of 562.47 g/mol. Its IUPAC name is 4-[(4-iodo-2-methyl-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide.
| Compound Name | 4-[(4-iodo-2-methyl-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 133200498 |
| Molecular Formula | C25H27IN2O3S |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 4-[(4-iodo-2-methyl-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide |
| SMILES | Cc1cc(I)ccc1N(Cc1ccc(C(=O)NCC(C)c2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H27IN2O3S/c1-18-15-23(26)13-14-24(18)28(32(3,30)31)17-20-9-11-22(12-10-20)25(29)27-16-19(2)21-7-5-4-6-8-21/h4-15,19H,16-17H2,1-3H3,(H,27,29) |
| InChIKey | LXSHENAIJMNGNB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|