C24H24Cl2N2O3S — CID 133202079
4-[(2,6-dichloro-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide (PubChem CID 133202079) has the molecular formula C24H24Cl2N2O3S and a molecular weight of 491.44 g/mol. Its IUPAC name is 4-[(2,6-dichloro-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide.
| Compound Name | 4-[(2,6-dichloro-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 133202079 |
| Molecular Formula | C24H24Cl2N2O3S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 4-[(2,6-dichloro-N-methylsulfonylanilino)methyl]-N-(2-phenylpropyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(CN(c2c(Cl)cccc2Cl)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24Cl2N2O3S/c1-17(19-7-4-3-5-8-19)15-27-24(29)20-13-11-18(12-14-20)16-28(32(2,30)31)23-21(25)9-6-10-22(23)26/h3-14,17H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | TWWGWPSRGRJJSM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |