C15H20ClN3O4 — CID 13320217
[4-(4-chlorophenoxy)-1-(dimethylcarbamoyl)pyrrolidin-3-yl] N-methylcarbamate (PubChem CID 13320217) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-1-(dimethylcarbamoyl)pyrrolidin-3-yl] N-methylcarbamate.
| Compound Name | [4-(4-chlorophenoxy)-1-(dimethylcarbamoyl)pyrrolidin-3-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 13320217 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [4-(4-chlorophenoxy)-1-(dimethylcarbamoyl)pyrrolidin-3-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1CN(C(=O)N(C)C)CC1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN3O4/c1-17-14(20)23-13-9-19(15(21)18(2)3)8-12(13)22-11-6-4-10(16)5-7-11/h4-7,12-13H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | FNDWRKAOKRBPPZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |