C18H27ClN2O4 — CID 69410725
tert-butyl N-[(2S)-4-[3-(4-chlorophenoxy)azetidin-1-yl]-1-hydroxybutan-2-yl]carbamate (PubChem CID 69410725) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[3-(4-chlorophenoxy)azetidin-1-yl]-1-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[3-(4-chlorophenoxy)azetidin-1-yl]-1-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69410725 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-[(2S)-4-[3-(4-chlorophenoxy)azetidin-1-yl]-1-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)CCN1CC(Oc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H27ClN2O4/c1-18(2,3)25-17(23)20-14(12-22)8-9-21-10-16(11-21)24-15-6-4-13(19)5-7-15/h4-7,14,16,22H,8-12H2,1-3H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | UCKQIVORCCWBRB-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |