C10H11Cl2NO2 — CID 13320223
4-(2,6-dichlorophenoxy)pyrrolidin-3-ol (PubChem CID 13320223) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 4-(2,6-dichlorophenoxy)pyrrolidin-3-ol.
| Compound Name | 4-(2,6-dichlorophenoxy)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 13320223 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-(2,6-dichlorophenoxy)pyrrolidin-3-ol |
| SMILES | OC1CNCC1Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c11-6-2-1-3-7(12)10(6)15-9-5-13-4-8(9)14/h1-3,8-9,13-14H,4-5H2 |
| InChIKey | ZXIDMMHTXZOWDR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |