C10H8F5NO2 — CID 114203459
(3S,4S)-4-(2,3,4,5,6-pentafluorophenoxy)pyrrolidin-3-ol (PubChem CID 114203459) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is (3S,4S)-4-(2,3,4,5,6-pentafluorophenoxy)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-(2,3,4,5,6-pentafluorophenoxy)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 114203459 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (3S,4S)-4-(2,3,4,5,6-pentafluorophenoxy)pyrrolidin-3-ol |
| SMILES | O[C@H]1CNC[C@@H]1Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8F5NO2/c11-5-6(12)8(14)10(9(15)7(5)13)18-4-2-16-1-3(4)17/h3-4,16-17H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | NZRDTVQMARMKLG-IMJSIDKUSA-N |
| XLogP | 1.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|