C9H7ClF5NO — CID 134524404
3-(2,3,4,5,6-pentafluorophenoxy)azetidine;hydrochloride (PubChem CID 134524404) has the molecular formula C9H7ClF5NO and a molecular weight of 275.60 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenoxy)azetidine;hydrochloride.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenoxy)azetidine;hydrochloride |
|---|---|
| PubChem CID | 134524404 |
| Molecular Formula | C9H7ClF5NO |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenoxy)azetidine;hydrochloride |
| SMILES | Cl.Fc1c(F)c(F)c(OC2CNC2)c(F)c1F |
| InChI | InChI=1S/C9H6F5NO.ClH/c10-4-5(11)7(13)9(8(14)6(4)12)16-3-1-15-2-3;/h3,15H,1-2H2;1H |
| InChIKey | WGWQWPGQEQSWJW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|