C8H6F5NO — CID 5305488
2-(2,3,4,5,6-pentafluorophenoxy)ethanamine (PubChem CID 5305488) has the molecular formula C8H6F5NO and a molecular weight of 227.13 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenoxy)ethanamine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 5305488 |
| Molecular Formula | C8H6F5NO |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethanamine |
| SMILES | NCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F5NO/c9-3-4(10)6(12)8(15-2-1-14)7(13)5(3)11/h1-2,14H2 |
| InChIKey | NLGUSCKEXHHEEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|