C9H9F2NO — CID 24902389
3-(2,4-difluorophenoxy)azetidine (PubChem CID 24902389) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)azetidine.
| Compound Name | 3-(2,4-difluorophenoxy)azetidine |
|---|---|
| PubChem CID | 24902389 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-(2,4-difluorophenoxy)azetidine |
| SMILES | Fc1ccc(OC2CNC2)c(F)c1 |
| InChI | InChI=1S/C9H9F2NO/c10-6-1-2-9(8(11)3-6)13-7-4-12-5-7/h1-3,7,12H,4-5H2 |
| InChIKey | UTNJOKZHZHVICP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |