C36H39BrFN3O6S — CID 133206162
2-[(3-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206162) has the molecular formula C36H39BrFN3O6S and a molecular weight of 740.69 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206162 |
| Molecular Formula | C36H39BrFN3O6S |
| Molecular Weight | 740.69 g/mol |
| Exact Mass | 739.17 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C36H39BrFN3O6S/c1-4-5-20-39-36(43)32(22-26-10-7-6-8-11-26)40(24-27-12-9-13-28(37)21-27)35(42)25-41(30-16-14-29(38)15-17-30)48(44,45)31-18-19-33(46-2)34(23-31)47-3/h6-19,21,23,32H,4-5,20,22,24-25H2,1-3H3,(H,39,43) |
| InChIKey | BIQBSHIKIJODEA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|