C15H20N2O4S2 — CID 133207615
2-oxo-N-(oxolan-2-ylmethyl)-3-propyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 133207615) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-oxo-N-(oxolan-2-ylmethyl)-3-propyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-oxo-N-(oxolan-2-ylmethyl)-3-propyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 133207615 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-oxo-N-(oxolan-2-ylmethyl)-3-propyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCCn1c(=O)sc2cc(S(=O)(=O)NCC3CCCO3)ccc21 |
| InChI | InChI=1S/C15H20N2O4S2/c1-2-7-17-13-6-5-12(9-14(13)22-15(17)18)23(19,20)16-10-11-4-3-8-21-11/h5-6,9,11,16H,2-4,7-8,10H2,1H3 |
| InChIKey | BMHCJQQOBRPMGY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |