C30H31N5O4S2 — CID 133208092
methyl 3-[3-[3-[4-(methanesulfonamido)-3-methylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 133208092) has the molecular formula C30H31N5O4S2 and a molecular weight of 589.74 g/mol. Its IUPAC name is methyl 3-[3-[3-[4-(methanesulfonamido)-3-methylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[3-[3-[4-(methanesulfonamido)-3-methylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133208092 |
| Molecular Formula | C30H31N5O4S2 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | methyl 3-[3-[3-[4-(methanesulfonamido)-3-methylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccc(NS(C)(=O)=O)c(C)c3)c2C)c1 |
| InChI | InChI=1S/C30H31N5O4S2/c1-18-15-23(12-13-25(18)33-41(5,37)38)35-28(27(32-30(35)40)26-11-6-7-14-31-26)24-16-19(2)34(20(24)3)22-10-8-9-21(17-22)29(36)39-4/h6-17,27-28,33H,1-5H3,(H,32,40) |
| InChIKey | BGEBGGGMFHGOCC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|