C31H32ClN5OS — CID 133209332
3-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide (PubChem CID 133209332) has the molecular formula C31H32ClN5OS and a molecular weight of 558.15 g/mol. Its IUPAC name is 3-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide.
| Compound Name | 3-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 133209332 |
| Molecular Formula | C31H32ClN5OS |
| Molecular Weight | 558.15 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCN2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(Cl)c3C)c2C)c1 |
| InChI | InChI=1S/C31H32ClN5OS/c1-19-9-7-10-23(17-19)34-28(38)14-16-36-30(29(35-31(36)39)26-12-5-6-15-33-26)24-18-20(2)37(22(24)4)27-13-8-11-25(32)21(27)3/h5-13,15,17-18,29-30H,14,16H2,1-4H3,(H,34,38)(H,35,39) |
| InChIKey | IYNONTTYZTUGPU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.15 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|