C24H33N3O5S — CID 133213974
2-[benzyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide (PubChem CID 133213974) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is 2-[benzyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133213974 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[benzyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide |
| SMILES | COCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C24H33N3O5S/c1-26(33(3,30)31)19-23(28)27(18-21-13-8-5-9-14-21)22(17-20-11-6-4-7-12-20)24(29)25-15-10-16-32-2/h4-9,11-14,22H,10,15-19H2,1-3H3,(H,25,29) |
| InChIKey | TVCNYXHCEZBARS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|