C23H30FN3O5S — CID 133215004
2-[(4-fluorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-hydroxypropyl)-3-phenylpropanamide (PubChem CID 133215004) has the molecular formula C23H30FN3O5S and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-hydroxypropyl)-3-phenylpropanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-hydroxypropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133215004 |
| Molecular Formula | C23H30FN3O5S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-hydroxypropyl)-3-phenylpropanamide |
| SMILES | CN(CC(=O)N(Cc1ccc(F)cc1)C(Cc1ccccc1)C(=O)NCCCO)S(C)(=O)=O |
| InChI | InChI=1S/C23H30FN3O5S/c1-26(33(2,31)32)17-22(29)27(16-19-9-11-20(24)12-10-19)21(23(30)25-13-6-14-28)15-18-7-4-3-5-8-18/h3-5,7-12,21,28H,6,13-17H2,1-2H3,(H,25,30) |
| InChIKey | CQHVVEVIOQREGA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|