C21H26INO3 — CID 133217376
2-(4-iodophenoxy)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]acetamide (PubChem CID 133217376) has the molecular formula C21H26INO3 and a molecular weight of 467.35 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 133217376 |
| Molecular Formula | C21H26INO3 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]acetamide |
| SMILES | COc1cc(C)c(C(C)NC(=O)COc2ccc(I)cc2)cc1C(C)C |
| InChI | InChI=1S/C21H26INO3/c1-13(2)18-11-19(14(3)10-20(18)25-5)15(4)23-21(24)12-26-17-8-6-16(22)7-9-17/h6-11,13,15H,12H2,1-5H3,(H,23,24) |
| InChIKey | UUPBMODPQSDPKP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|