C25H21FN4S — CID 133224248
1-(4-fluoro-3-methylphenyl)-5-(1-phenylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224248) has the molecular formula C25H21FN4S and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-5-(1-phenylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-5-(1-phenylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224248 |
| Molecular Formula | C25H21FN4S |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-5-(1-phenylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)NC(c3ccccn3)C2c2ccn(-c3ccccc3)c2)ccc1F |
| InChI | InChI=1S/C25H21FN4S/c1-17-15-20(10-11-21(17)26)30-24(23(28-25(30)31)22-9-5-6-13-27-22)18-12-14-29(16-18)19-7-3-2-4-8-19/h2-16,23-24H,1H3,(H,28,31) |
| InChIKey | XTAZVRLRLQCBPK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|