C20H19FN4S — CID 100503713
(4S,5R)-1-(4-fluoro-3-methylphenyl)-5-(5-methyl-1H-pyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100503713) has the molecular formula C20H19FN4S and a molecular weight of 366.47 g/mol. Its IUPAC name is (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-(5-methyl-1H-pyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-(5-methyl-1H-pyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100503713 |
| Molecular Formula | C20H19FN4S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-(5-methyl-1H-pyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(F)c(C)c2)[nH]1 |
| InChI | InChI=1S/C20H19FN4S/c1-12-11-14(7-8-15(12)21)25-19(17-9-6-13(2)23-17)18(24-20(25)26)16-5-3-4-10-22-16/h3-11,18-19,23H,1-2H3,(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | ITSSZGXHYBBQKD-MOPGFXCFSA-N |
| XLogP | 4.34 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|