C19H21Cl2NO — CID 133225019
3-(2,6-dichlorophenyl)-N-[1-(2,5-dimethylphenyl)ethyl]propanamide (PubChem CID 133225019) has the molecular formula C19H21Cl2NO and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[1-(2,5-dimethylphenyl)ethyl]propanamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[1-(2,5-dimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 133225019 |
| Molecular Formula | C19H21Cl2NO |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[1-(2,5-dimethylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)CCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO/c1-12-7-8-13(2)16(11-12)14(3)22-19(23)10-9-15-17(20)5-4-6-18(15)21/h4-8,11,14H,9-10H2,1-3H3,(H,22,23) |
| InChIKey | PBAVANQOMJWUSY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |