C23H21Cl2NO — CID 100602252
3-(2,6-dichlorophenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]propanamide (PubChem CID 100602252) has the molecular formula C23H21Cl2NO and a molecular weight of 398.33 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]propanamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]propanamide |
|---|---|
| PubChem CID | 100602252 |
| Molecular Formula | C23H21Cl2NO |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]propanamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)CCc1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H21Cl2NO/c1-16-8-5-6-11-18(16)23(17-9-3-2-4-10-17)26-22(27)15-14-19-20(24)12-7-13-21(19)25/h2-13,23H,14-15H2,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | YBQLFMHWSKEGRI-HSZRJFAPSA-N |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |